C34H32N2 — CID 167454384
ethane;3-methyl-9H-carbazole;9-(3-methylphenyl)carbazole (PubChem CID 167454384) has the molecular formula C34H32N2 and a molecular weight of 468.64 g/mol. Its IUPAC name is ethane;3-methyl-9H-carbazole;9-(3-methylphenyl)carbazole.
| Compound Name | ethane;3-methyl-9H-carbazole;9-(3-methylphenyl)carbazole |
|---|---|
| PubChem CID | 167454384 |
| Molecular Formula | C34H32N2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | ethane;3-methyl-9H-carbazole;9-(3-methylphenyl)carbazole |
| SMILES | CC.Cc1ccc2[nH]c3ccccc3c2c1.Cc1cccc(-n2c3ccccc3c3ccccc32)c1 |
| InChI | InChI=1S/C19H15N.C13H11N.C2H6/c1-14-7-6-8-15(13-14)20-18-11-4-2-9-16(18)17-10-3-5-12-19(17)20;1-9-6-7-13-11(8-9)10-4-2-3-5-12(10)14-13;1-2/h2-13H,1H3;2-8,14H,1H3;1-2H3 |
| InChIKey | VPDITBLQGVPLMC-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |