C23H30N2O2 — CID 167454779
5-(2-methoxyethoxymethyl)-N-(3-methylbutyl)-2-phenyl-1H-indol-7-amine (PubChem CID 167454779) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 5-(2-methoxyethoxymethyl)-N-(3-methylbutyl)-2-phenyl-1H-indol-7-amine.
| Compound Name | 5-(2-methoxyethoxymethyl)-N-(3-methylbutyl)-2-phenyl-1H-indol-7-amine |
|---|---|
| PubChem CID | 167454779 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 5-(2-methoxyethoxymethyl)-N-(3-methylbutyl)-2-phenyl-1H-indol-7-amine |
| SMILES | COCCOCc1cc(NCCC(C)C)c2[nH]c(-c3ccccc3)cc2c1 |
| InChI | InChI=1S/C23H30N2O2/c1-17(2)9-10-24-22-14-18(16-27-12-11-26-3)13-20-15-21(25-23(20)22)19-7-5-4-6-8-19/h4-8,13-15,17,24-25H,9-12,16H2,1-3H3 |
| InChIKey | AIBMSURPBYCXRN-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|