C14H16O4 — CID 16745523
(3aR,5R,5aS,8aS,9aS)-8a-hydroxy-5-methyl-1-methylidene-3a,4,5,5a,9,9a-hexahydroazuleno[6,7-b]furan-2,8-dione (PubChem CID 16745523) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is (3aR,5R,5aS,8aS,9aS)-8a-hydroxy-5-methyl-1-methylidene-3a,4,5,5a,9,9a-hexahydroazuleno[6,7-b]furan-2,8-dione.
| Compound Name | (3aR,5R,5aS,8aS,9aS)-8a-hydroxy-5-methyl-1-methylidene-3a,4,5,5a,9,9a-hexahydroazuleno[6,7-b]furan-2,8-dione |
|---|---|
| PubChem CID | 16745523 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (3aR,5R,5aS,8aS,9aS)-8a-hydroxy-5-methyl-1-methylidene-3a,4,5,5a,9,9a-hexahydroazuleno[6,7-b]furan-2,8-dione |
| SMILES | C=C1C(=O)O[C@@H]2C[C@@H](C)[C@H]3C=CC(=O)[C@]3(O)C[C@@H]12 |
| InChI | InChI=1S/C14H16O4/c1-7-5-11-9(8(2)13(16)18-11)6-14(17)10(7)3-4-12(14)15/h3-4,7,9-11,17H,2,5-6H2,1H3/t7-,9+,10-,11-,14+/m1/s1 |
| InChIKey | KLMULHKUMZKNJD-WZVUWSIYSA-N |
| XLogP | 1.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|