C19H20F2O2 — CID 167455564
[1,1-difluoro-3-methyl-1-(3-phenylphenyl)butan-2-yl] acetate (PubChem CID 167455564) has the molecular formula C19H20F2O2 and a molecular weight of 318.36 g/mol. Its IUPAC name is [1,1-difluoro-3-methyl-1-(3-phenylphenyl)butan-2-yl] acetate.
| Compound Name | [1,1-difluoro-3-methyl-1-(3-phenylphenyl)butan-2-yl] acetate |
|---|---|
| PubChem CID | 167455564 |
| Molecular Formula | C19H20F2O2 |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | [1,1-difluoro-3-methyl-1-(3-phenylphenyl)butan-2-yl] acetate |
| SMILES | CC(=O)OC(C(C)C)C(F)(F)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C19H20F2O2/c1-13(2)18(23-14(3)22)19(20,21)17-11-7-10-16(12-17)15-8-5-4-6-9-15/h4-13,18H,1-3H3 |
| InChIKey | ORHQDMUXHFWRBL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |