About (7-methyl-6,8-dioxo-3-thiophen-3-ylisochromen-7-yl) 3-phenylpropanoate
(7-methyl-6,8-dioxo-3-thiophen-3-ylisochromen-7-yl) 3-phenylpropanoate (PubChem CID 16745581) has the molecular formula C23H18O5S
and a molecular weight of 406.46 g/mol. Its IUPAC name is (7-methyl-6,8-dioxo-3-thiophen-3-ylisochromen-7-yl) 3-phenylpropanoate.
Molecular Properties
| Compound Name | (7-methyl-6,8-dioxo-3-thiophen-3-ylisochromen-7-yl) 3-phenylpropanoate |
| PubChem CID | 16745581 |
| Molecular Formula | C23H18O5S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | (7-methyl-6,8-dioxo-3-thiophen-3-ylisochromen-7-yl) 3-phenylpropanoate |
| SMILES | CC1(OC(=O)CCc2ccccc2)C(=O)C=C2C=C(c3ccsc3)OC=C2C1=O |
| InChI | InChI=1S/C23H18O5S/c1-23(28-21(25)8-7-15-5-3-2-4-6-15)20(24)12-17-11-19(16-9-10-29-14-16)27-13-18(17)22(23)26/h2-6,9-14H,7-8H2,1H3 |
| InChIKey | DIHDSEMUVWKYSB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (7-methyl-6,8-dioxo-3-thiophen-3-ylisochromen-7-yl) 3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-methyl-6,8-dioxo-3-thiophen-3-ylisochromen-7-yl) 3-phenylpropanoate?
The IUPAC name of (7-methyl-6,8-dioxo-3-thiophen-3-ylisochromen-7-yl) 3-phenylpropanoate (CID 16745581) is (7-methyl-6,8-dioxo-3-thiophen-3-ylisochromen-7-yl) 3-phenylpropanoate.
What is the SMILES notation for (7-methyl-6,8-dioxo-3-thiophen-3-ylisochromen-7-yl) 3-phenylpropanoate?
The canonical SMILES for (7-methyl-6,8-dioxo-3-thiophen-3-ylisochromen-7-yl) 3-phenylpropanoate is CC1(OC(=O)CCc2ccccc2)C(=O)C=C2C=C(c3ccsc3)OC=C2C1=O.
What is the InChIKey of (7-methyl-6,8-dioxo-3-thiophen-3-ylisochromen-7-yl) 3-phenylpropanoate?
The InChIKey is DIHDSEMUVWKYSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18O5S/c1-23(28-21(25)8-7-15-5-3-2-4-6-15)20(24)12-17-11-19(16-9-10-29-14-16)27-13-18(17)22(23)26/h2-6,9-14H,7-8H2,1H3.
What are the key properties of (7-methyl-6,8-dioxo-3-thiophen-3-ylisochromen-7-yl) 3-phenylpropanoate?
(7-methyl-6,8-dioxo-3-thiophen-3-ylisochromen-7-yl) 3-phenylpropanoate has a molecular weight of 406.46 g/mol, XLogP of 4.02, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (7-methyl-6,8-dioxo-3-thiophen-3-ylisochromen-7-yl) 3-phenylpropanoate is sourced from PubChem (CID 16745581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).