About [3-butyl-2-(4-methoxyphenyl)-7-methyl-6,8-dioxoisoquinolin-7-yl] propanoate
[3-butyl-2-(4-methoxyphenyl)-7-methyl-6,8-dioxoisoquinolin-7-yl] propanoate (PubChem CID 16745614) has the molecular formula C24H27NO5
and a molecular weight of 409.48 g/mol. Its IUPAC name is [3-butyl-2-(4-methoxyphenyl)-7-methyl-6,8-dioxoisoquinolin-7-yl] propanoate.
Molecular Properties
| Compound Name | [3-butyl-2-(4-methoxyphenyl)-7-methyl-6,8-dioxoisoquinolin-7-yl] propanoate |
| PubChem CID | 16745614 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | [3-butyl-2-(4-methoxyphenyl)-7-methyl-6,8-dioxoisoquinolin-7-yl] propanoate |
| SMILES | CCCCC1=CC2=CC(=O)C(C)(OC(=O)CC)C(=O)C2=CN1c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H27NO5/c1-5-7-8-18-13-16-14-21(26)24(3,30-22(27)6-2)23(28)20(16)15-25(18)17-9-11-19(29-4)12-10-17/h9-15H,5-8H2,1-4H3 |
| InChIKey | UOLSVOSVYYBVSQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze [3-butyl-2-(4-methoxyphenyl)-7-methyl-6,8-dioxoisoquinolin-7-yl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-butyl-2-(4-methoxyphenyl)-7-methyl-6,8-dioxoisoquinolin-7-yl] propanoate?
The IUPAC name of [3-butyl-2-(4-methoxyphenyl)-7-methyl-6,8-dioxoisoquinolin-7-yl] propanoate (CID 16745614) is [3-butyl-2-(4-methoxyphenyl)-7-methyl-6,8-dioxoisoquinolin-7-yl] propanoate.
What is the SMILES notation for [3-butyl-2-(4-methoxyphenyl)-7-methyl-6,8-dioxoisoquinolin-7-yl] propanoate?
The canonical SMILES for [3-butyl-2-(4-methoxyphenyl)-7-methyl-6,8-dioxoisoquinolin-7-yl] propanoate is CCCCC1=CC2=CC(=O)C(C)(OC(=O)CC)C(=O)C2=CN1c1ccc(OC)cc1.
What is the InChIKey of [3-butyl-2-(4-methoxyphenyl)-7-methyl-6,8-dioxoisoquinolin-7-yl] propanoate?
The InChIKey is UOLSVOSVYYBVSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27NO5/c1-5-7-8-18-13-16-14-21(26)24(3,30-22(27)6-2)23(28)20(16)15-25(18)17-9-11-19(29-4)12-10-17/h9-15H,5-8H2,1-4H3.
What are the key properties of [3-butyl-2-(4-methoxyphenyl)-7-methyl-6,8-dioxoisoquinolin-7-yl] propanoate?
[3-butyl-2-(4-methoxyphenyl)-7-methyl-6,8-dioxoisoquinolin-7-yl] propanoate has a molecular weight of 409.48 g/mol, XLogP of 4.26, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-butyl-2-(4-methoxyphenyl)-7-methyl-6,8-dioxoisoquinolin-7-yl] propanoate is sourced from PubChem (CID 16745614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).