About [3-butyl-7-methyl-6,8-dioxo-2-(2-pyridin-2-ylethyl)isoquinolin-7-yl] propanoate
[3-butyl-7-methyl-6,8-dioxo-2-(2-pyridin-2-ylethyl)isoquinolin-7-yl] propanoate (PubChem CID 16745616) has the molecular formula C24H28N2O4
and a molecular weight of 408.50 g/mol. Its IUPAC name is [3-butyl-7-methyl-6,8-dioxo-2-(2-pyridin-2-ylethyl)isoquinolin-7-yl] propanoate.
Molecular Properties
| Compound Name | [3-butyl-7-methyl-6,8-dioxo-2-(2-pyridin-2-ylethyl)isoquinolin-7-yl] propanoate |
| PubChem CID | 16745616 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | [3-butyl-7-methyl-6,8-dioxo-2-(2-pyridin-2-ylethyl)isoquinolin-7-yl] propanoate |
| SMILES | CCCCC1=CC2=CC(=O)C(C)(OC(=O)CC)C(=O)C2=CN1CCc1ccccn1 |
| InChI | InChI=1S/C24H28N2O4/c1-4-6-10-19-14-17-15-21(27)24(3,30-22(28)5-2)23(29)20(17)16-26(19)13-11-18-9-7-8-12-25-18/h7-9,12,14-16H,4-6,10-11,13H2,1-3H3 |
| InChIKey | PUDAQALYEILFRD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze [3-butyl-7-methyl-6,8-dioxo-2-(2-pyridin-2-ylethyl)isoquinolin-7-yl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-butyl-7-methyl-6,8-dioxo-2-(2-pyridin-2-ylethyl)isoquinolin-7-yl] propanoate?
The IUPAC name of [3-butyl-7-methyl-6,8-dioxo-2-(2-pyridin-2-ylethyl)isoquinolin-7-yl] propanoate (CID 16745616) is [3-butyl-7-methyl-6,8-dioxo-2-(2-pyridin-2-ylethyl)isoquinolin-7-yl] propanoate.
What is the SMILES notation for [3-butyl-7-methyl-6,8-dioxo-2-(2-pyridin-2-ylethyl)isoquinolin-7-yl] propanoate?
The canonical SMILES for [3-butyl-7-methyl-6,8-dioxo-2-(2-pyridin-2-ylethyl)isoquinolin-7-yl] propanoate is CCCCC1=CC2=CC(=O)C(C)(OC(=O)CC)C(=O)C2=CN1CCc1ccccn1.
What is the InChIKey of [3-butyl-7-methyl-6,8-dioxo-2-(2-pyridin-2-ylethyl)isoquinolin-7-yl] propanoate?
The InChIKey is PUDAQALYEILFRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28N2O4/c1-4-6-10-19-14-17-15-21(27)24(3,30-22(28)5-2)23(29)20(17)16-26(19)13-11-18-9-7-8-12-25-18/h7-9,12,14-16H,4-6,10-11,13H2,1-3H3.
What are the key properties of [3-butyl-7-methyl-6,8-dioxo-2-(2-pyridin-2-ylethyl)isoquinolin-7-yl] propanoate?
[3-butyl-7-methyl-6,8-dioxo-2-(2-pyridin-2-ylethyl)isoquinolin-7-yl] propanoate has a molecular weight of 408.50 g/mol, XLogP of 3.69, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-butyl-7-methyl-6,8-dioxo-2-(2-pyridin-2-ylethyl)isoquinolin-7-yl] propanoate is sourced from PubChem (CID 16745616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).