C22H26F2N2O5S — CID 167456277
[3-[[2-(difluoromethoxy)-6-methyl-3-pyridinyl]carbamoyl]-3-(2-propan-2-ylphenyl)cyclobutyl] methanesulfonate (PubChem CID 167456277) has the molecular formula C22H26F2N2O5S and a molecular weight of 468.52 g/mol. Its IUPAC name is [3-[[2-(difluoromethoxy)-6-methyl-3-pyridinyl]carbamoyl]-3-(2-propan-2-ylphenyl)cyclobutyl] methanesulfonate.
| Compound Name | [3-[[2-(difluoromethoxy)-6-methyl-3-pyridinyl]carbamoyl]-3-(2-propan-2-ylphenyl)cyclobutyl] methanesulfonate |
|---|---|
| PubChem CID | 167456277 |
| Molecular Formula | C22H26F2N2O5S |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | [3-[[2-(difluoromethoxy)-6-methyl-3-pyridinyl]carbamoyl]-3-(2-propan-2-ylphenyl)cyclobutyl] methanesulfonate |
| SMILES | Cc1ccc(NC(=O)C2(c3ccccc3C(C)C)CC(OS(C)(=O)=O)C2)c(OC(F)F)n1 |
| InChI | InChI=1S/C22H26F2N2O5S/c1-13(2)16-7-5-6-8-17(16)22(11-15(12-22)31-32(4,28)29)20(27)26-18-10-9-14(3)25-19(18)30-21(23)24/h5-10,13,15,21H,11-12H2,1-4H3,(H,26,27) |
| InChIKey | IXRVWBHIPKQMRO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|