About CID 167457138
CID 167457138 (PubChem CID 167457138) has the molecular formula C7H4BF2NO2
and a molecular weight of 182.92 g/mol.
Molecular Properties
| Compound Name | CID 167457138 |
| PubChem CID | 167457138 |
| Molecular Formula | C7H4BF2NO2 |
| Molecular Weight | 182.92 g/mol |
| Exact Mass | 183.03 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C=O)nc1OC(F)F |
| InChI | InChI=1S/C7H4BF2NO2/c8-5-2-1-4(3-12)11-6(5)13-7(9)10/h1-3,7H |
| InChIKey | GRPCKAJRHAJVNP-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.92 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 167457138 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167457138?
The IUPAC name of CID 167457138 (CID 167457138) is not available.
What is the SMILES notation for CID 167457138?
The canonical SMILES for CID 167457138 is [B]c1ccc(C=O)nc1OC(F)F.
What is the InChIKey of CID 167457138?
The InChIKey is GRPCKAJRHAJVNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BF2NO2/c8-5-2-1-4(3-12)11-6(5)13-7(9)10/h1-3,7H.
What are the key properties of CID 167457138?
CID 167457138 has a molecular weight of 182.92 g/mol, XLogP of 0.29, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167457138 is sourced from PubChem (CID 167457138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).