C17H32O4Si — CID 167457342
(4aR,6S,7S,7aR)-2,2-ditert-butyl-7-methoxy-6-prop-2-enyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasiline (PubChem CID 167457342) has the molecular formula C17H32O4Si and a molecular weight of 328.53 g/mol. Its IUPAC name is (4aR,6S,7S,7aR)-2,2-ditert-butyl-7-methoxy-6-prop-2-enyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasiline.
| Compound Name | (4aR,6S,7S,7aR)-2,2-ditert-butyl-7-methoxy-6-prop-2-enyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasiline |
|---|---|
| PubChem CID | 167457342 |
| Molecular Formula | C17H32O4Si |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | (4aR,6S,7S,7aR)-2,2-ditert-butyl-7-methoxy-6-prop-2-enyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasiline |
| SMILES | C=CC[C@@H]1O[C@@H]2CO[Si](C(C)(C)C)(C(C)(C)C)O[C@H]2[C@H]1OC |
| InChI | InChI=1S/C17H32O4Si/c1-9-10-12-14(18-8)15-13(20-12)11-19-22(21-15,16(2,3)4)17(5,6)7/h9,12-15H,1,10-11H2,2-8H3/t12-,13+,14-,15+/m0/s1 |
| InChIKey | VLCHIKMICWNLIJ-LJISPDSOSA-N |
| XLogP | 3.80 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|