C16H19BrF2N2O2 — CID 167457415
(9Z)-9-[(E)-4-bromopent-3-en-2-ylidene]-2,2-difluoro-8-oxo-7,10-diazadispiro[2.2.46.23]dodecane-10-carbaldehyde (PubChem CID 167457415) has the molecular formula C16H19BrF2N2O2 and a molecular weight of 389.24 g/mol. Its IUPAC name is (9Z)-9-[(E)-4-bromopent-3-en-2-ylidene]-2,2-difluoro-8-oxo-7,10-diazadispiro[2.2.46.23]dodecane-10-carbaldehyde.
| Compound Name | (9Z)-9-[(E)-4-bromopent-3-en-2-ylidene]-2,2-difluoro-8-oxo-7,10-diazadispiro[2.2.46.23]dodecane-10-carbaldehyde |
|---|---|
| PubChem CID | 167457415 |
| Molecular Formula | C16H19BrF2N2O2 |
| Molecular Weight | 389.24 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | (9Z)-9-[(E)-4-bromopent-3-en-2-ylidene]-2,2-difluoro-8-oxo-7,10-diazadispiro[2.2.46.23]dodecane-10-carbaldehyde |
| SMILES | CC(/C=C(\C)Br)=C1\C(=O)NC2(CCC3(CC2)CC3(F)F)N1C=O |
| InChI | InChI=1S/C16H19BrF2N2O2/c1-10(7-11(2)17)12-13(23)20-15(21(12)9-22)5-3-14(4-6-15)8-16(14,18)19/h7,9H,3-6,8H2,1-2H3,(H,20,23)/b11-7+,12-10- |
| InChIKey | VEQZVWASGAVPPZ-LBNSGORRSA-N |
| XLogP | 3.44 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.24 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|