About 1-(4,4-dimethylpiperidin-1-yl)prop-2-en-1-one;ethane;propane
1-(4,4-dimethylpiperidin-1-yl)prop-2-en-1-one;ethane;propane (PubChem CID 167457745) has the molecular formula C15H31NO
and a molecular weight of 241.42 g/mol. Its IUPAC name is 1-(4,4-dimethylpiperidin-1-yl)prop-2-en-1-one;ethane;propane.
Molecular Properties
| Compound Name | 1-(4,4-dimethylpiperidin-1-yl)prop-2-en-1-one;ethane;propane |
| PubChem CID | 167457745 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | 1-(4,4-dimethylpiperidin-1-yl)prop-2-en-1-one;ethane;propane |
| SMILES | C=CC(=O)N1CCC(C)(C)CC1.CC.CCC |
| InChI | InChI=1S/C10H17NO.C3H8.C2H6/c1-4-9(12)11-7-5-10(2,3)6-8-11;1-3-2;1-2/h4H,1,5-8H2,2-3H3;3H2,1-2H3;1-2H3 |
| InChIKey | BASOYPDBPRDOSQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,4-dimethylpiperidin-1-yl)prop-2-en-1-one;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,4-dimethylpiperidin-1-yl)prop-2-en-1-one;ethane;propane?
The IUPAC name of 1-(4,4-dimethylpiperidin-1-yl)prop-2-en-1-one;ethane;propane (CID 167457745) is 1-(4,4-dimethylpiperidin-1-yl)prop-2-en-1-one;ethane;propane.
What is the SMILES notation for 1-(4,4-dimethylpiperidin-1-yl)prop-2-en-1-one;ethane;propane?
The canonical SMILES for 1-(4,4-dimethylpiperidin-1-yl)prop-2-en-1-one;ethane;propane is C=CC(=O)N1CCC(C)(C)CC1.CC.CCC.
What is the InChIKey of 1-(4,4-dimethylpiperidin-1-yl)prop-2-en-1-one;ethane;propane?
The InChIKey is BASOYPDBPRDOSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO.C3H8.C2H6/c1-4-9(12)11-7-5-10(2,3)6-8-11;1-3-2;1-2/h4H,1,5-8H2,2-3H3;3H2,1-2H3;1-2H3.
What are the key properties of 1-(4,4-dimethylpiperidin-1-yl)prop-2-en-1-one;ethane;propane?
1-(4,4-dimethylpiperidin-1-yl)prop-2-en-1-one;ethane;propane has a molecular weight of 241.42 g/mol, XLogP of 4.26, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4-dimethylpiperidin-1-yl)prop-2-en-1-one;ethane;propane is sourced from PubChem (CID 167457745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).