About ethane;[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl] N-butylcarbamate
ethane;[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl] N-butylcarbamate (PubChem CID 167457881) has the molecular formula C15H27NO2
and a molecular weight of 253.39 g/mol. Its IUPAC name is ethane;[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl] N-butylcarbamate.
Molecular Properties
| Compound Name | ethane;[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl] N-butylcarbamate |
| PubChem CID | 167457881 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | ethane;[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl] N-butylcarbamate |
| SMILES | C=C/C=C(\C=C/C)COC(=O)NCCCC.CC |
| InChI | InChI=1S/C13H21NO2.C2H6/c1-4-7-10-14-13(15)16-11-12(8-5-2)9-6-3;1-2/h5-6,8-9H,2,4,7,10-11H2,1,3H3,(H,14,15);1-2H3/b9-6-,12-8+; |
| InChIKey | JJGZFPVCEQKKTG-XMFKKTQZSA-N |
| XLogP | 4.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl] N-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl] N-butylcarbamate?
The IUPAC name of ethane;[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl] N-butylcarbamate (CID 167457881) is ethane;[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl] N-butylcarbamate.
What is the SMILES notation for ethane;[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl] N-butylcarbamate?
The canonical SMILES for ethane;[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl] N-butylcarbamate is C=C/C=C(\C=C/C)COC(=O)NCCCC.CC.
What is the InChIKey of ethane;[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl] N-butylcarbamate?
The InChIKey is JJGZFPVCEQKKTG-XMFKKTQZSA-N. The full InChI is InChI=1S/C13H21NO2.C2H6/c1-4-7-10-14-13(15)16-11-12(8-5-2)9-6-3;1-2/h5-6,8-9H,2,4,7,10-11H2,1,3H3,(H,14,15);1-2H3/b9-6-,12-8+;.
What are the key properties of ethane;[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl] N-butylcarbamate?
ethane;[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl] N-butylcarbamate has a molecular weight of 253.39 g/mol, XLogP of 4.23, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl] N-butylcarbamate is sourced from PubChem (CID 167457881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).