About 3-cyclohexyl-1,3-thiazolidin-2-imine
3-cyclohexyl-1,3-thiazolidin-2-imine (PubChem CID 167458153) has the molecular formula C9H16N2S
and a molecular weight of 184.31 g/mol. Its IUPAC name is 3-cyclohexyl-1,3-thiazolidin-2-imine.
Molecular Properties
| Compound Name | 3-cyclohexyl-1,3-thiazolidin-2-imine |
| PubChem CID | 167458153 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 3-cyclohexyl-1,3-thiazolidin-2-imine |
| SMILES | [H]/N=C1\SCCN1C1CCCCC1 |
| InChI | InChI=1S/C9H16N2S/c10-9-11(6-7-12-9)8-4-2-1-3-5-8/h8,10H,1-7H2/b10-9- |
| InChIKey | IGRCMUJNPPXHSQ-KTKRTIGZSA-N |
| XLogP | 2.30 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclohexyl-1,3-thiazolidin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-1,3-thiazolidin-2-imine?
The IUPAC name of 3-cyclohexyl-1,3-thiazolidin-2-imine (CID 167458153) is 3-cyclohexyl-1,3-thiazolidin-2-imine.
What is the SMILES notation for 3-cyclohexyl-1,3-thiazolidin-2-imine?
The canonical SMILES for 3-cyclohexyl-1,3-thiazolidin-2-imine is [H]/N=C1\SCCN1C1CCCCC1.
What is the InChIKey of 3-cyclohexyl-1,3-thiazolidin-2-imine?
The InChIKey is IGRCMUJNPPXHSQ-KTKRTIGZSA-N. The full InChI is InChI=1S/C9H16N2S/c10-9-11(6-7-12-9)8-4-2-1-3-5-8/h8,10H,1-7H2/b10-9-.
What are the key properties of 3-cyclohexyl-1,3-thiazolidin-2-imine?
3-cyclohexyl-1,3-thiazolidin-2-imine has a molecular weight of 184.31 g/mol, XLogP of 2.30, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-1,3-thiazolidin-2-imine is sourced from PubChem (CID 167458153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).