C13H13ClN2O3S — CID 167458182
ethyl (NZ)-N-[3-(2-chlorophenyl)-4-(hydroxymethyl)-1,3-thiazol-2-ylidene]carbamate (PubChem CID 167458182) has the molecular formula C13H13ClN2O3S and a molecular weight of 312.78 g/mol. Its IUPAC name is ethyl (NZ)-N-[3-(2-chlorophenyl)-4-(hydroxymethyl)-1,3-thiazol-2-ylidene]carbamate.
| Compound Name | ethyl (NZ)-N-[3-(2-chlorophenyl)-4-(hydroxymethyl)-1,3-thiazol-2-ylidene]carbamate |
|---|---|
| PubChem CID | 167458182 |
| Molecular Formula | C13H13ClN2O3S |
| Molecular Weight | 312.78 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | ethyl (NZ)-N-[3-(2-chlorophenyl)-4-(hydroxymethyl)-1,3-thiazol-2-ylidene]carbamate |
| SMILES | CCOC(=O)/N=c1\scc(CO)n1-c1ccccc1Cl |
| InChI | InChI=1S/C13H13ClN2O3S/c1-2-19-13(18)15-12-16(9(7-17)8-20-12)11-6-4-3-5-10(11)14/h3-6,8,17H,2,7H2,1H3/b15-12- |
| InChIKey | WYPQKEZXJSZWCB-QINSGFPZSA-N |
| XLogP | 2.74 |
| TPSA | 63.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.78 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|