C16H19N5O3 — CID 16745830
8'-amino-3'-methylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione (PubChem CID 16745830) has the molecular formula C16H19N5O3 and a molecular weight of 329.36 g/mol. Its IUPAC name is 8'-amino-3'-methylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione.
| Compound Name | 8'-amino-3'-methylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 16745830 |
| Molecular Formula | C16H19N5O3 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 8'-amino-3'-methylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
| SMILES | CN1CCN2c3ccc(N)cc3CC3(C(=O)NC(=O)NC3=O)C2C1 |
| InChI | InChI=1S/C16H19N5O3/c1-20-4-5-21-11-3-2-10(17)6-9(11)7-16(12(21)8-20)13(22)18-15(24)19-14(16)23/h2-3,6,12H,4-5,7-8,17H2,1H3,(H2,18,19,22,23,24) |
| InChIKey | OCFXTFSAEODUHM-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|