C12H13N3O5 — CID 16745844
azanium 5-(1,3-benzodioxol-5-ylmethyl)-2,4-dioxo-1H-pyrimidin-6-olate (PubChem CID 16745844) has the molecular formula C12H13N3O5 and a molecular weight of 279.25 g/mol. Its IUPAC name is azanium 5-(1,3-benzodioxol-5-ylmethyl)-2,4-dioxo-1H-pyrimidin-6-olate.
| Compound Name | azanium 5-(1,3-benzodioxol-5-ylmethyl)-2,4-dioxo-1H-pyrimidin-6-olate |
|---|---|
| PubChem CID | 16745844 |
| Molecular Formula | C12H13N3O5 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | azanium 5-(1,3-benzodioxol-5-ylmethyl)-2,4-dioxo-1H-pyrimidin-6-olate |
| SMILES | O=c1[nH]c([O-])c(Cc2ccc3c(c2)OCO3)c(=O)[nH]1.[NH4+] |
| InChI | InChI=1S/C12H10N2O5.H3N/c15-10-7(11(16)14-12(17)13-10)3-6-1-2-8-9(4-6)19-5-18-8;/h1-2,4H,3,5H2,(H3,13,14,15,16,17);1H3 |
| InChIKey | YNGQBKIBKABALC-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 143.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |