C13H17N3O5 — CID 16745849
azanium 5-[(2,4-dimethoxyphenyl)methyl]-2,4-dioxo-1H-pyrimidin-6-olate (PubChem CID 16745849) has the molecular formula C13H17N3O5 and a molecular weight of 295.30 g/mol. Its IUPAC name is azanium 5-[(2,4-dimethoxyphenyl)methyl]-2,4-dioxo-1H-pyrimidin-6-olate.
| Compound Name | azanium 5-[(2,4-dimethoxyphenyl)methyl]-2,4-dioxo-1H-pyrimidin-6-olate |
|---|---|
| PubChem CID | 16745849 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | azanium 5-[(2,4-dimethoxyphenyl)methyl]-2,4-dioxo-1H-pyrimidin-6-olate |
| SMILES | COc1ccc(Cc2c([O-])[nH]c(=O)[nH]c2=O)c(OC)c1.[NH4+] |
| InChI | InChI=1S/C13H14N2O5.H3N/c1-19-8-4-3-7(10(6-8)20-2)5-9-11(16)14-13(18)15-12(9)17;/h3-4,6H,5H2,1-2H3,(H3,14,15,16,17,18);1H3 |
| InChIKey | KTPKEMXEGUEOGS-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 143.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |