About N,N-dimethyl-1-(6-propan-2-yl-2-pyridinyl)methanamine;3-methoxyoxolane
N,N-dimethyl-1-(6-propan-2-yl-2-pyridinyl)methanamine;3-methoxyoxolane (PubChem CID 167458551) has the molecular formula C16H28N2O2
and a molecular weight of 280.41 g/mol. Its IUPAC name is N,N-dimethyl-1-(6-propan-2-yl-2-pyridinyl)methanamine;3-methoxyoxolane.
Molecular Properties
| Compound Name | N,N-dimethyl-1-(6-propan-2-yl-2-pyridinyl)methanamine;3-methoxyoxolane |
| PubChem CID | 167458551 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | N,N-dimethyl-1-(6-propan-2-yl-2-pyridinyl)methanamine;3-methoxyoxolane |
| SMILES | CC(C)c1cccc(CN(C)C)n1.COC1CCOC1 |
| InChI | InChI=1S/C11H18N2.C5H10O2/c1-9(2)11-7-5-6-10(12-11)8-13(3)4;1-6-5-2-3-7-4-5/h5-7,9H,8H2,1-4H3;5H,2-4H2,1H3 |
| InChIKey | SGIKWIFWNRTYOC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-dimethyl-1-(6-propan-2-yl-2-pyridinyl)methanamine;3-methoxyoxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-1-(6-propan-2-yl-2-pyridinyl)methanamine;3-methoxyoxolane?
The IUPAC name of N,N-dimethyl-1-(6-propan-2-yl-2-pyridinyl)methanamine;3-methoxyoxolane (CID 167458551) is N,N-dimethyl-1-(6-propan-2-yl-2-pyridinyl)methanamine;3-methoxyoxolane.
What is the SMILES notation for N,N-dimethyl-1-(6-propan-2-yl-2-pyridinyl)methanamine;3-methoxyoxolane?
The canonical SMILES for N,N-dimethyl-1-(6-propan-2-yl-2-pyridinyl)methanamine;3-methoxyoxolane is CC(C)c1cccc(CN(C)C)n1.COC1CCOC1.
What is the InChIKey of N,N-dimethyl-1-(6-propan-2-yl-2-pyridinyl)methanamine;3-methoxyoxolane?
The InChIKey is SGIKWIFWNRTYOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2.C5H10O2/c1-9(2)11-7-5-6-10(12-11)8-13(3)4;1-6-5-2-3-7-4-5/h5-7,9H,8H2,1-4H3;5H,2-4H2,1H3.
What are the key properties of N,N-dimethyl-1-(6-propan-2-yl-2-pyridinyl)methanamine;3-methoxyoxolane?
N,N-dimethyl-1-(6-propan-2-yl-2-pyridinyl)methanamine;3-methoxyoxolane has a molecular weight of 280.41 g/mol, XLogP of 2.69, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-1-(6-propan-2-yl-2-pyridinyl)methanamine;3-methoxyoxolane is sourced from PubChem (CID 167458551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).