About 2-imino-N,N,3-trimethylbut-3-en-1-amine;methane
2-imino-N,N,3-trimethylbut-3-en-1-amine;methane (PubChem CID 167458585) has the molecular formula C8H18N2
and a molecular weight of 142.25 g/mol. Its IUPAC name is 2-imino-N,N,3-trimethylbut-3-en-1-amine;methane.
Molecular Properties
| Compound Name | 2-imino-N,N,3-trimethylbut-3-en-1-amine;methane |
| PubChem CID | 167458585 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | 2-imino-N,N,3-trimethylbut-3-en-1-amine;methane |
| SMILES | C.[H]/N=C(\CN(C)C)C(=C)C |
| InChI | InChI=1S/C7H14N2.CH4/c1-6(2)7(8)5-9(3)4;/h8H,1,5H2,2-4H3;1H4/b8-7+; |
| InChIKey | HOAGALVEHJOPQB-USRGLUTNSA-N |
| XLogP | 1.78 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-imino-N,N,3-trimethylbut-3-en-1-amine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imino-N,N,3-trimethylbut-3-en-1-amine;methane?
The IUPAC name of 2-imino-N,N,3-trimethylbut-3-en-1-amine;methane (CID 167458585) is 2-imino-N,N,3-trimethylbut-3-en-1-amine;methane.
What is the SMILES notation for 2-imino-N,N,3-trimethylbut-3-en-1-amine;methane?
The canonical SMILES for 2-imino-N,N,3-trimethylbut-3-en-1-amine;methane is C.[H]/N=C(\CN(C)C)C(=C)C.
What is the InChIKey of 2-imino-N,N,3-trimethylbut-3-en-1-amine;methane?
The InChIKey is HOAGALVEHJOPQB-USRGLUTNSA-N. The full InChI is InChI=1S/C7H14N2.CH4/c1-6(2)7(8)5-9(3)4;/h8H,1,5H2,2-4H3;1H4/b8-7+;.
What are the key properties of 2-imino-N,N,3-trimethylbut-3-en-1-amine;methane?
2-imino-N,N,3-trimethylbut-3-en-1-amine;methane has a molecular weight of 142.25 g/mol, XLogP of 1.78, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imino-N,N,3-trimethylbut-3-en-1-amine;methane is sourced from PubChem (CID 167458585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).