About 3-imino-N,N,4-trimethylpent-4-en-2-amine
3-imino-N,N,4-trimethylpent-4-en-2-amine (PubChem CID 167458890) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is 3-imino-N,N,4-trimethylpent-4-en-2-amine.
Molecular Properties
| Compound Name | 3-imino-N,N,4-trimethylpent-4-en-2-amine |
| PubChem CID | 167458890 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 3-imino-N,N,4-trimethylpent-4-en-2-amine |
| SMILES | [H]/N=C(\C(=C)C)C(C)N(C)C |
| InChI | InChI=1S/C8H16N2/c1-6(2)8(9)7(3)10(4)5/h7,9H,1H2,2-5H3/b9-8+ |
| InChIKey | BJFMCSVSSQYYAG-CMDGGOBGSA-N |
| XLogP | 1.53 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-imino-N,N,4-trimethylpent-4-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imino-N,N,4-trimethylpent-4-en-2-amine?
The IUPAC name of 3-imino-N,N,4-trimethylpent-4-en-2-amine (CID 167458890) is 3-imino-N,N,4-trimethylpent-4-en-2-amine.
What is the SMILES notation for 3-imino-N,N,4-trimethylpent-4-en-2-amine?
The canonical SMILES for 3-imino-N,N,4-trimethylpent-4-en-2-amine is [H]/N=C(\C(=C)C)C(C)N(C)C.
What is the InChIKey of 3-imino-N,N,4-trimethylpent-4-en-2-amine?
The InChIKey is BJFMCSVSSQYYAG-CMDGGOBGSA-N. The full InChI is InChI=1S/C8H16N2/c1-6(2)8(9)7(3)10(4)5/h7,9H,1H2,2-5H3/b9-8+.
What are the key properties of 3-imino-N,N,4-trimethylpent-4-en-2-amine?
3-imino-N,N,4-trimethylpent-4-en-2-amine has a molecular weight of 140.23 g/mol, XLogP of 1.53, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imino-N,N,4-trimethylpent-4-en-2-amine is sourced from PubChem (CID 167458890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).