C14H15N3O3 — CID 167459315
N,N-dimethyl-5-(2-methyl-4-nitrophenoxy)pyridin-2-amine (PubChem CID 167459315) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is N,N-dimethyl-5-(2-methyl-4-nitrophenoxy)pyridin-2-amine.
| Compound Name | N,N-dimethyl-5-(2-methyl-4-nitrophenoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 167459315 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N,N-dimethyl-5-(2-methyl-4-nitrophenoxy)pyridin-2-amine |
| SMILES | Cc1cc([N+](=O)[O-])ccc1Oc1ccc(N(C)C)nc1 |
| InChI | InChI=1S/C14H15N3O3/c1-10-8-11(17(18)19)4-6-13(10)20-12-5-7-14(15-9-12)16(2)3/h4-9H,1-3H3 |
| InChIKey | HMRZCYHOLIYPKQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|