About (6R)-6-butyl-1-(2,2-dimethylpropyl)piperazine-2,3-dione
(6R)-6-butyl-1-(2,2-dimethylpropyl)piperazine-2,3-dione (PubChem CID 16745935) has the molecular formula C13H24N2O2
and a molecular weight of 240.35 g/mol. Its IUPAC name is (6R)-6-butyl-1-(2,2-dimethylpropyl)piperazine-2,3-dione.
Molecular Properties
| Compound Name | (6R)-6-butyl-1-(2,2-dimethylpropyl)piperazine-2,3-dione |
| PubChem CID | 16745935 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | (6R)-6-butyl-1-(2,2-dimethylpropyl)piperazine-2,3-dione |
| SMILES | CCCC[C@@H]1CNC(=O)C(=O)N1CC(C)(C)C |
| InChI | InChI=1S/C13H24N2O2/c1-5-6-7-10-8-14-11(16)12(17)15(10)9-13(2,3)4/h10H,5-9H2,1-4H3,(H,14,16)/t10-/m1/s1 |
| InChIKey | IRKVZYLFLQPGTO-SNVBAGLBSA-N |
| XLogP | 1.55 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze (6R)-6-butyl-1-(2,2-dimethylpropyl)piperazine-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-butyl-1-(2,2-dimethylpropyl)piperazine-2,3-dione?
The IUPAC name of (6R)-6-butyl-1-(2,2-dimethylpropyl)piperazine-2,3-dione (CID 16745935) is (6R)-6-butyl-1-(2,2-dimethylpropyl)piperazine-2,3-dione.
What is the SMILES notation for (6R)-6-butyl-1-(2,2-dimethylpropyl)piperazine-2,3-dione?
The canonical SMILES for (6R)-6-butyl-1-(2,2-dimethylpropyl)piperazine-2,3-dione is CCCC[C@@H]1CNC(=O)C(=O)N1CC(C)(C)C.
What is the InChIKey of (6R)-6-butyl-1-(2,2-dimethylpropyl)piperazine-2,3-dione?
The InChIKey is IRKVZYLFLQPGTO-SNVBAGLBSA-N. The full InChI is InChI=1S/C13H24N2O2/c1-5-6-7-10-8-14-11(16)12(17)15(10)9-13(2,3)4/h10H,5-9H2,1-4H3,(H,14,16)/t10-/m1/s1.
What are the key properties of (6R)-6-butyl-1-(2,2-dimethylpropyl)piperazine-2,3-dione?
(6R)-6-butyl-1-(2,2-dimethylpropyl)piperazine-2,3-dione has a molecular weight of 240.35 g/mol, XLogP of 1.55, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-butyl-1-(2,2-dimethylpropyl)piperazine-2,3-dione is sourced from PubChem (CID 16745935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).