About (2S,5S)-5-hydroxy-7,7-dimethoxy-2-phenylmethoxyheptan-3-one
(2S,5S)-5-hydroxy-7,7-dimethoxy-2-phenylmethoxyheptan-3-one (PubChem CID 16745968) has the molecular formula C16H24O5
and a molecular weight of 296.36 g/mol. Its IUPAC name is (2S,5S)-5-hydroxy-7,7-dimethoxy-2-phenylmethoxyheptan-3-one.
Molecular Properties
| Compound Name | (2S,5S)-5-hydroxy-7,7-dimethoxy-2-phenylmethoxyheptan-3-one |
| PubChem CID | 16745968 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (2S,5S)-5-hydroxy-7,7-dimethoxy-2-phenylmethoxyheptan-3-one |
| SMILES | COC(C[C@H](O)CC(=O)[C@H](C)OCc1ccccc1)OC |
| InChI | InChI=1S/C16H24O5/c1-12(21-11-13-7-5-4-6-8-13)15(18)9-14(17)10-16(19-2)20-3/h4-8,12,14,16-17H,9-11H2,1-3H3/t12-,14+/m0/s1 |
| InChIKey | HHPHPIWOADJUBY-GXTWGEPZSA-N |
| XLogP | 1.92 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2S,5S)-5-hydroxy-7,7-dimethoxy-2-phenylmethoxyheptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5S)-5-hydroxy-7,7-dimethoxy-2-phenylmethoxyheptan-3-one?
The IUPAC name of (2S,5S)-5-hydroxy-7,7-dimethoxy-2-phenylmethoxyheptan-3-one (CID 16745968) is (2S,5S)-5-hydroxy-7,7-dimethoxy-2-phenylmethoxyheptan-3-one.
What is the SMILES notation for (2S,5S)-5-hydroxy-7,7-dimethoxy-2-phenylmethoxyheptan-3-one?
The canonical SMILES for (2S,5S)-5-hydroxy-7,7-dimethoxy-2-phenylmethoxyheptan-3-one is COC(C[C@H](O)CC(=O)[C@H](C)OCc1ccccc1)OC.
What is the InChIKey of (2S,5S)-5-hydroxy-7,7-dimethoxy-2-phenylmethoxyheptan-3-one?
The InChIKey is HHPHPIWOADJUBY-GXTWGEPZSA-N. The full InChI is InChI=1S/C16H24O5/c1-12(21-11-13-7-5-4-6-8-13)15(18)9-14(17)10-16(19-2)20-3/h4-8,12,14,16-17H,9-11H2,1-3H3/t12-,14+/m0/s1.
What are the key properties of (2S,5S)-5-hydroxy-7,7-dimethoxy-2-phenylmethoxyheptan-3-one?
(2S,5S)-5-hydroxy-7,7-dimethoxy-2-phenylmethoxyheptan-3-one has a molecular weight of 296.36 g/mol, XLogP of 1.92, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5S)-5-hydroxy-7,7-dimethoxy-2-phenylmethoxyheptan-3-one is sourced from PubChem (CID 16745968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).