About (E)-6,6-dimethoxy-1-phenylmethoxyhex-3-en-2-one
(E)-6,6-dimethoxy-1-phenylmethoxyhex-3-en-2-one (PubChem CID 16745970) has the molecular formula C15H20O4
and a molecular weight of 264.32 g/mol. Its IUPAC name is (E)-6,6-dimethoxy-1-phenylmethoxyhex-3-en-2-one.
Molecular Properties
| Compound Name | (E)-6,6-dimethoxy-1-phenylmethoxyhex-3-en-2-one |
| PubChem CID | 16745970 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (E)-6,6-dimethoxy-1-phenylmethoxyhex-3-en-2-one |
| SMILES | COC(C/C=C/C(=O)COCc1ccccc1)OC |
| InChI | InChI=1S/C15H20O4/c1-17-15(18-2)10-6-9-14(16)12-19-11-13-7-4-3-5-8-13/h3-9,15H,10-12H2,1-2H3/b9-6+ |
| InChIKey | XIUWTOIXOGOCCZ-RMKNXTFCSA-N |
| XLogP | 2.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-6,6-dimethoxy-1-phenylmethoxyhex-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-6,6-dimethoxy-1-phenylmethoxyhex-3-en-2-one?
The IUPAC name of (E)-6,6-dimethoxy-1-phenylmethoxyhex-3-en-2-one (CID 16745970) is (E)-6,6-dimethoxy-1-phenylmethoxyhex-3-en-2-one.
What is the SMILES notation for (E)-6,6-dimethoxy-1-phenylmethoxyhex-3-en-2-one?
The canonical SMILES for (E)-6,6-dimethoxy-1-phenylmethoxyhex-3-en-2-one is COC(C/C=C/C(=O)COCc1ccccc1)OC.
What is the InChIKey of (E)-6,6-dimethoxy-1-phenylmethoxyhex-3-en-2-one?
The InChIKey is XIUWTOIXOGOCCZ-RMKNXTFCSA-N. The full InChI is InChI=1S/C15H20O4/c1-17-15(18-2)10-6-9-14(16)12-19-11-13-7-4-3-5-8-13/h3-9,15H,10-12H2,1-2H3/b9-6+.
What are the key properties of (E)-6,6-dimethoxy-1-phenylmethoxyhex-3-en-2-one?
(E)-6,6-dimethoxy-1-phenylmethoxyhex-3-en-2-one has a molecular weight of 264.32 g/mol, XLogP of 2.34, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-6,6-dimethoxy-1-phenylmethoxyhex-3-en-2-one is sourced from PubChem (CID 16745970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).