C20H23F3IN3O — CID 167460002
N-[2-cyclohexyl-4-(trifluoromethyl)phenyl]-2-(4-iodopyrazol-1-yl)-2-methylpropanamide (PubChem CID 167460002) has the molecular formula C20H23F3IN3O and a molecular weight of 505.32 g/mol. Its IUPAC name is N-[2-cyclohexyl-4-(trifluoromethyl)phenyl]-2-(4-iodopyrazol-1-yl)-2-methylpropanamide.
| Compound Name | N-[2-cyclohexyl-4-(trifluoromethyl)phenyl]-2-(4-iodopyrazol-1-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 167460002 |
| Molecular Formula | C20H23F3IN3O |
| Molecular Weight | 505.32 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | N-[2-cyclohexyl-4-(trifluoromethyl)phenyl]-2-(4-iodopyrazol-1-yl)-2-methylpropanamide |
| SMILES | CC(C)(C(=O)Nc1ccc(C(F)(F)F)cc1C1CCCCC1)n1cc(I)cn1 |
| InChI | InChI=1S/C20H23F3IN3O/c1-19(2,27-12-15(24)11-25-27)18(28)26-17-9-8-14(20(21,22)23)10-16(17)13-6-4-3-5-7-13/h8-13H,3-7H2,1-2H3,(H,26,28) |
| InChIKey | LUNPFKJVYJIEQL-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.32 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|