C15H24O5 — CID 16746012
(2S,4S)-6,6-dimethoxy-1-phenylmethoxyhexane-2,4-diol (PubChem CID 16746012) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is (2S,4S)-6,6-dimethoxy-1-phenylmethoxyhexane-2,4-diol.
| Compound Name | (2S,4S)-6,6-dimethoxy-1-phenylmethoxyhexane-2,4-diol |
|---|---|
| PubChem CID | 16746012 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (2S,4S)-6,6-dimethoxy-1-phenylmethoxyhexane-2,4-diol |
| SMILES | COC(C[C@@H](O)C[C@H](O)COCc1ccccc1)OC |
| InChI | InChI=1S/C15H24O5/c1-18-15(19-2)9-13(16)8-14(17)11-20-10-12-6-4-3-5-7-12/h3-7,13-17H,8-11H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | JKQSWJHBQZFSJX-KBPBESRZSA-N |
| XLogP | 1.32 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|