C21H24ClN3O2 — CID 167460442
(10R)-10-[(6-oxo-4-phenylpyrimidin-1-yl)methyl]-7-azaspiro[4.5]decane-7-carbonyl chloride (PubChem CID 167460442) has the molecular formula C21H24ClN3O2 and a molecular weight of 385.90 g/mol. Its IUPAC name is (10R)-10-[(6-oxo-4-phenylpyrimidin-1-yl)methyl]-7-azaspiro[4.5]decane-7-carbonyl chloride.
| Compound Name | (10R)-10-[(6-oxo-4-phenylpyrimidin-1-yl)methyl]-7-azaspiro[4.5]decane-7-carbonyl chloride |
|---|---|
| PubChem CID | 167460442 |
| Molecular Formula | C21H24ClN3O2 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | (10R)-10-[(6-oxo-4-phenylpyrimidin-1-yl)methyl]-7-azaspiro[4.5]decane-7-carbonyl chloride |
| SMILES | O=C(Cl)N1CC[C@@H](Cn2cnc(-c3ccccc3)cc2=O)C2(CCCC2)C1 |
| InChI | InChI=1S/C21H24ClN3O2/c22-20(27)24-11-8-17(21(14-24)9-4-5-10-21)13-25-15-23-18(12-19(25)26)16-6-2-1-3-7-16/h1-3,6-7,12,15,17H,4-5,8-11,13-14H2/t17-/m0/s1 |
| InChIKey | CZMKWYANKJUSKC-KRWDZBQOSA-N |
| XLogP | 4.15 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|