C26H38N6 — CID 167460684
N-[(3Z)-3-ethenylhexa-3,5-dienyl]-N'-[[(1R,3S)-3-(3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-3-yl)cyclopentyl]methyl]propane-1,3-diamine (PubChem CID 167460684) has the molecular formula C26H38N6 and a molecular weight of 434.63 g/mol. Its IUPAC name is N-[(3Z)-3-ethenylhexa-3,5-dienyl]-N'-[[(1R,3S)-3-(3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-3-yl)cyclopentyl]methyl]propane-1,3-diamine.
| Compound Name | N-[(3Z)-3-ethenylhexa-3,5-dienyl]-N'-[[(1R,3S)-3-(3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-3-yl)cyclopentyl]methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 167460684 |
| Molecular Formula | C26H38N6 |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.32 |
| IUPAC Name | N-[(3Z)-3-ethenylhexa-3,5-dienyl]-N'-[[(1R,3S)-3-(3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-3-yl)cyclopentyl]methyl]propane-1,3-diamine |
| SMILES | C=C/C=C(\C=C)CCNCCCNC[C@@H]1CC[C@H](n2cc3c4c(ncnc42)NCCC3)C1 |
| InChI | InChI=1S/C26H38N6/c1-3-7-20(4-2)11-15-27-12-6-13-28-17-21-9-10-23(16-21)32-18-22-8-5-14-29-25-24(22)26(32)31-19-30-25/h3-4,7,18-19,21,23,27-28H,1-2,5-6,8-17H2,(H,29,30,31)/b20-7+/t21-,23+/m1/s1 |
| InChIKey | FTBROOLEZBJVKP-ICOCUGHHSA-N |
| XLogP | 4.39 |
| TPSA | 66.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|