C18H22O5 — CID 167461501
(3aR,6R,6aR)-2,2-dimethyl-6-[3-(2-methyl-1,3-dioxolan-2-yl)phenyl]-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-one (PubChem CID 167461501) has the molecular formula C18H22O5 and a molecular weight of 318.37 g/mol. Its IUPAC name is (3aR,6R,6aR)-2,2-dimethyl-6-[3-(2-methyl-1,3-dioxolan-2-yl)phenyl]-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-one.
| Compound Name | (3aR,6R,6aR)-2,2-dimethyl-6-[3-(2-methyl-1,3-dioxolan-2-yl)phenyl]-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 167461501 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | (3aR,6R,6aR)-2,2-dimethyl-6-[3-(2-methyl-1,3-dioxolan-2-yl)phenyl]-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-one |
| SMILES | CC1(C)O[C@@H]2[C@@H](c3cccc(C4(C)OCCO4)c3)CC(=O)[C@@H]2O1 |
| InChI | InChI=1S/C18H22O5/c1-17(2)22-15-13(10-14(19)16(15)23-17)11-5-4-6-12(9-11)18(3)20-7-8-21-18/h4-6,9,13,15-16H,7-8,10H2,1-3H3/t13-,15-,16+/m1/s1 |
| InChIKey | ILHJBYPSIPODCD-BMFZPTHFSA-N |
| XLogP | 2.48 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |