C19H20N2O4S — CID 167461584
N-[3-[(3aR,6R,6aR)-2,2-dimethyl-4-oxo-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-6-yl]-5-(1,2-thiazol-4-yl)phenyl]acetamide (PubChem CID 167461584) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is N-[3-[(3aR,6R,6aR)-2,2-dimethyl-4-oxo-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-6-yl]-5-(1,2-thiazol-4-yl)phenyl]acetamide.
| Compound Name | N-[3-[(3aR,6R,6aR)-2,2-dimethyl-4-oxo-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-6-yl]-5-(1,2-thiazol-4-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 167461584 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | N-[3-[(3aR,6R,6aR)-2,2-dimethyl-4-oxo-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-6-yl]-5-(1,2-thiazol-4-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(-c2cnsc2)cc([C@H]2CC(=O)[C@@H]3OC(C)(C)O[C@H]23)c1 |
| InChI | InChI=1S/C19H20N2O4S/c1-10(22)21-14-5-11(13-8-20-26-9-13)4-12(6-14)15-7-16(23)18-17(15)24-19(2,3)25-18/h4-6,8-9,15,17-18H,7H2,1-3H3,(H,21,22)/t15-,17-,18+/m1/s1 |
| InChIKey | PVTKUMMTYKKWRN-NXHRZFHOSA-N |
| XLogP | 3.35 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |