C30H37BrN6O3 — CID 167461630
(1R,2S,3R,5R)-3-[5-bromo-4-(methylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-[[3-[2-(3-phenoxyphenyl)ethylamino]propylamino]methyl]cyclopentane-1,2-diol (PubChem CID 167461630) has the molecular formula C30H37BrN6O3 and a molecular weight of 609.57 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[5-bromo-4-(methylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-[[3-[2-(3-phenoxyphenyl)ethylamino]propylamino]methyl]cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[5-bromo-4-(methylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-[[3-[2-(3-phenoxyphenyl)ethylamino]propylamino]methyl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 167461630 |
| Molecular Formula | C30H37BrN6O3 |
| Molecular Weight | 609.57 g/mol |
| Exact Mass | 608.21 |
| IUPAC Name | (1R,2S,3R,5R)-3-[5-bromo-4-(methylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-[[3-[2-(3-phenoxyphenyl)ethylamino]propylamino]methyl]cyclopentane-1,2-diol |
| SMILES | CNc1ncnc2c1c(Br)cn2[C@@H]1C[C@H](CNCCCNCCc2cccc(Oc3ccccc3)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C30H37BrN6O3/c1-32-29-26-24(31)18-37(30(26)36-19-35-29)25-16-21(27(38)28(25)39)17-34-13-6-12-33-14-11-20-7-5-10-23(15-20)40-22-8-3-2-4-9-22/h2-5,7-10,15,18-19,21,25,27-28,33-34,38-39H,6,11-14,16-17H2,1H3,(H,32,35,36)/t21-,25-,27-,28+/m1/s1 |
| InChIKey | YSJHHXUHNPQYFG-ZKVOMWIJSA-N |
| XLogP | 4.12 |
| TPSA | 116.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.57 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|