C27H31ClFN5O2S — CID 167461639
(1R,2S,3R)-3-(2-chloro-5-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[[3-[2-(4-fluorophenyl)ethylamino]propylamino]methyl]cyclopentane-1,2-diol (PubChem CID 167461639) has the molecular formula C27H31ClFN5O2S and a molecular weight of 544.10 g/mol. Its IUPAC name is (1R,2S,3R)-3-(2-chloro-5-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[[3-[2-(4-fluorophenyl)ethylamino]propylamino]methyl]cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R)-3-(2-chloro-5-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[[3-[2-(4-fluorophenyl)ethylamino]propylamino]methyl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 167461639 |
| Molecular Formula | C27H31ClFN5O2S |
| Molecular Weight | 544.10 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | (1R,2S,3R)-3-(2-chloro-5-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[[3-[2-(4-fluorophenyl)ethylamino]propylamino]methyl]cyclopentane-1,2-diol |
| SMILES | O[C@@H]1[C@H](O)C(CNCCCNCCc2ccc(F)cc2)C[C@H]1n1cc(-c2cccs2)c2cnc(Cl)nc21 |
| InChI | InChI=1S/C27H31ClFN5O2S/c28-27-32-15-20-21(23-3-1-12-37-23)16-34(26(20)33-27)22-13-18(24(35)25(22)36)14-31-10-2-9-30-11-8-17-4-6-19(29)7-5-17/h1,3-7,12,15-16,18,22,24-25,30-31,35-36H,2,8-11,13-14H2/t18?,22-,24-,25+/m1/s1 |
| InChIKey | PSPYBAJLZCEIIT-MPNFQNRFSA-N |
| XLogP | 4.05 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.10 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|