C11H20O5 — CID 16746177
(2S,5R,7R,9R,10S)-7-(2-hydroxyethyl)-2-methyl-1,6-dioxaspiro[4.5]decane-9,10-diol (PubChem CID 16746177) has the molecular formula C11H20O5 and a molecular weight of 232.28 g/mol. Its IUPAC name is (2S,5R,7R,9R,10S)-7-(2-hydroxyethyl)-2-methyl-1,6-dioxaspiro[4.5]decane-9,10-diol.
| Compound Name | (2S,5R,7R,9R,10S)-7-(2-hydroxyethyl)-2-methyl-1,6-dioxaspiro[4.5]decane-9,10-diol |
|---|---|
| PubChem CID | 16746177 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | (2S,5R,7R,9R,10S)-7-(2-hydroxyethyl)-2-methyl-1,6-dioxaspiro[4.5]decane-9,10-diol |
| SMILES | C[C@H]1CC[C@]2(O[C@H](CCO)C[C@@H](O)[C@@H]2O)O1 |
| InChI | InChI=1S/C11H20O5/c1-7-2-4-11(15-7)10(14)9(13)6-8(16-11)3-5-12/h7-10,12-14H,2-6H2,1H3/t7-,8+,9+,10-,11+/m0/s1 |
| InChIKey | QFIGEICYFVBHEQ-UNQZSWDGSA-N |
| XLogP | -0.23 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |