C12H14O3S — CID 167462001
(3aR,6S,6aR)-2,2-dimethyl-6-thiophen-2-yl-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-one (PubChem CID 167462001) has the molecular formula C12H14O3S and a molecular weight of 238.31 g/mol. Its IUPAC name is (3aR,6S,6aR)-2,2-dimethyl-6-thiophen-2-yl-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-one.
| Compound Name | (3aR,6S,6aR)-2,2-dimethyl-6-thiophen-2-yl-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 167462001 |
| Molecular Formula | C12H14O3S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | (3aR,6S,6aR)-2,2-dimethyl-6-thiophen-2-yl-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-one |
| SMILES | CC1(C)O[C@@H]2[C@@H](c3cccs3)CC(=O)[C@@H]2O1 |
| InChI | InChI=1S/C12H14O3S/c1-12(2)14-10-7(9-4-3-5-16-9)6-8(13)11(10)15-12/h3-5,7,10-11H,6H2,1-2H3/t7-,10-,11+/m1/s1 |
| InChIKey | YWRZYIANLNGUTJ-ONOSFVFSSA-N |
| XLogP | 2.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |