C29H34ClFN6O2 — CID 167462079
(1R,2S,3R,5R)-3-(4-amino-2-chloro-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[[3-[2-(4-fluorophenyl)ethylamino]propylamino]methyl]cyclopentane-1,2-diol (PubChem CID 167462079) has the molecular formula C29H34ClFN6O2 and a molecular weight of 553.08 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-(4-amino-2-chloro-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[[3-[2-(4-fluorophenyl)ethylamino]propylamino]methyl]cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-(4-amino-2-chloro-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[[3-[2-(4-fluorophenyl)ethylamino]propylamino]methyl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 167462079 |
| Molecular Formula | C29H34ClFN6O2 |
| Molecular Weight | 553.08 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | (1R,2S,3R,5R)-3-(4-amino-2-chloro-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[[3-[2-(4-fluorophenyl)ethylamino]propylamino]methyl]cyclopentane-1,2-diol |
| SMILES | Nc1nc(Cl)nc2c1c(-c1ccccc1)cn2[C@@H]1C[C@H](CNCCCNCCc2ccc(F)cc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C29H34ClFN6O2/c30-29-35-27(32)24-22(19-5-2-1-3-6-19)17-37(28(24)36-29)23-15-20(25(38)26(23)39)16-34-13-4-12-33-14-11-18-7-9-21(31)10-8-18/h1-3,5-10,17,20,23,25-26,33-34,38-39H,4,11-16H2,(H2,32,35,36)/t20-,23-,25-,26+/m1/s1 |
| InChIKey | GAXYAVKZQVQZDY-FIOYLPRWSA-N |
| XLogP | 3.57 |
| TPSA | 121.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.08 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|