About 3-(5,7-dimethoxy-2-oxochromen-8-yl)-3-[4-(dimethylamino)phenyl]-N,N-diethylpropanamide
3-(5,7-dimethoxy-2-oxochromen-8-yl)-3-[4-(dimethylamino)phenyl]-N,N-diethylpropanamide (PubChem CID 16746263) has the molecular formula C26H32N2O5
and a molecular weight of 452.55 g/mol. Its IUPAC name is 3-(5,7-dimethoxy-2-oxochromen-8-yl)-3-[4-(dimethylamino)phenyl]-N,N-diethylpropanamide.
Molecular Properties
| Compound Name | 3-(5,7-dimethoxy-2-oxochromen-8-yl)-3-[4-(dimethylamino)phenyl]-N,N-diethylpropanamide |
| PubChem CID | 16746263 |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 3-(5,7-dimethoxy-2-oxochromen-8-yl)-3-[4-(dimethylamino)phenyl]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CC(c1ccc(N(C)C)cc1)c1c(OC)cc(OC)c2ccc(=O)oc12 |
| InChI | InChI=1S/C26H32N2O5/c1-7-28(8-2)23(29)15-20(17-9-11-18(12-10-17)27(3)4)25-22(32-6)16-21(31-5)19-13-14-24(30)33-26(19)25/h9-14,16,20H,7-8,15H2,1-6H3 |
| InChIKey | UFEBPIZUJRVZRS-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-(5,7-dimethoxy-2-oxochromen-8-yl)-3-[4-(dimethylamino)phenyl]-N,N-diethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5,7-dimethoxy-2-oxochromen-8-yl)-3-[4-(dimethylamino)phenyl]-N,N-diethylpropanamide?
The IUPAC name of 3-(5,7-dimethoxy-2-oxochromen-8-yl)-3-[4-(dimethylamino)phenyl]-N,N-diethylpropanamide (CID 16746263) is 3-(5,7-dimethoxy-2-oxochromen-8-yl)-3-[4-(dimethylamino)phenyl]-N,N-diethylpropanamide.
What is the SMILES notation for 3-(5,7-dimethoxy-2-oxochromen-8-yl)-3-[4-(dimethylamino)phenyl]-N,N-diethylpropanamide?
The canonical SMILES for 3-(5,7-dimethoxy-2-oxochromen-8-yl)-3-[4-(dimethylamino)phenyl]-N,N-diethylpropanamide is CCN(CC)C(=O)CC(c1ccc(N(C)C)cc1)c1c(OC)cc(OC)c2ccc(=O)oc12.
What is the InChIKey of 3-(5,7-dimethoxy-2-oxochromen-8-yl)-3-[4-(dimethylamino)phenyl]-N,N-diethylpropanamide?
The InChIKey is UFEBPIZUJRVZRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32N2O5/c1-7-28(8-2)23(29)15-20(17-9-11-18(12-10-17)27(3)4)25-22(32-6)16-21(31-5)19-13-14-24(30)33-26(19)25/h9-14,16,20H,7-8,15H2,1-6H3.
What are the key properties of 3-(5,7-dimethoxy-2-oxochromen-8-yl)-3-[4-(dimethylamino)phenyl]-N,N-diethylpropanamide?
3-(5,7-dimethoxy-2-oxochromen-8-yl)-3-[4-(dimethylamino)phenyl]-N,N-diethylpropanamide has a molecular weight of 452.55 g/mol, XLogP of 4.27, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5,7-dimethoxy-2-oxochromen-8-yl)-3-[4-(dimethylamino)phenyl]-N,N-diethylpropanamide is sourced from PubChem (CID 16746263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).