C33H38N2O7 — CID 16746268
5,7-dimethoxy-8-[3-(4-phenylpiperazin-1-yl)-1-(3,4,5-trimethoxyphenyl)propyl]chromen-2-one (PubChem CID 16746268) has the molecular formula C33H38N2O7 and a molecular weight of 574.67 g/mol. Its IUPAC name is 5,7-dimethoxy-8-[3-(4-phenylpiperazin-1-yl)-1-(3,4,5-trimethoxyphenyl)propyl]chromen-2-one.
| Compound Name | 5,7-dimethoxy-8-[3-(4-phenylpiperazin-1-yl)-1-(3,4,5-trimethoxyphenyl)propyl]chromen-2-one |
|---|---|
| PubChem CID | 16746268 |
| Molecular Formula | C33H38N2O7 |
| Molecular Weight | 574.67 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | 5,7-dimethoxy-8-[3-(4-phenylpiperazin-1-yl)-1-(3,4,5-trimethoxyphenyl)propyl]chromen-2-one |
| SMILES | COc1cc(C(CCN2CCN(c3ccccc3)CC2)c2c(OC)cc(OC)c3ccc(=O)oc23)cc(OC)c1OC |
| InChI | InChI=1S/C33H38N2O7/c1-37-26-21-27(38-2)31(32-25(26)11-12-30(36)42-32)24(22-19-28(39-3)33(41-5)29(20-22)40-4)13-14-34-15-17-35(18-16-34)23-9-7-6-8-10-23/h6-12,19-21,24H,13-18H2,1-5H3 |
| InChIKey | XKIPIKHAXOFXLT-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 82.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.67 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|