C27H33NO7 — CID 16746269
5,7-dimethoxy-8-[3-pyrrolidin-1-yl-1-(3,4,5-trimethoxyphenyl)propyl]chromen-2-one (PubChem CID 16746269) has the molecular formula C27H33NO7 and a molecular weight of 483.56 g/mol. Its IUPAC name is 5,7-dimethoxy-8-[3-pyrrolidin-1-yl-1-(3,4,5-trimethoxyphenyl)propyl]chromen-2-one.
| Compound Name | 5,7-dimethoxy-8-[3-pyrrolidin-1-yl-1-(3,4,5-trimethoxyphenyl)propyl]chromen-2-one |
|---|---|
| PubChem CID | 16746269 |
| Molecular Formula | C27H33NO7 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 5,7-dimethoxy-8-[3-pyrrolidin-1-yl-1-(3,4,5-trimethoxyphenyl)propyl]chromen-2-one |
| SMILES | COc1cc(C(CCN2CCCC2)c2c(OC)cc(OC)c3ccc(=O)oc23)cc(OC)c1OC |
| InChI | InChI=1S/C27H33NO7/c1-30-20-16-21(31-2)25(26-19(20)8-9-24(29)35-26)18(10-13-28-11-6-7-12-28)17-14-22(32-3)27(34-5)23(15-17)33-4/h8-9,14-16,18H,6-7,10-13H2,1-5H3 |
| InChIKey | NDXYJOLKUBRFEL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 79.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|