C25H29FN2O3 — CID 16746280
(6Z)-4-[(4-fluorophenyl)methyl]-5-(4-methoxyphenyl)-1-pentanoyl-5,8-dihydro-2H-1,4-diazocin-3-one (PubChem CID 16746280) has the molecular formula C25H29FN2O3 and a molecular weight of 424.52 g/mol. Its IUPAC name is (6Z)-4-[(4-fluorophenyl)methyl]-5-(4-methoxyphenyl)-1-pentanoyl-5,8-dihydro-2H-1,4-diazocin-3-one.
| Compound Name | (6Z)-4-[(4-fluorophenyl)methyl]-5-(4-methoxyphenyl)-1-pentanoyl-5,8-dihydro-2H-1,4-diazocin-3-one |
|---|---|
| PubChem CID | 16746280 |
| Molecular Formula | C25H29FN2O3 |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | (6Z)-4-[(4-fluorophenyl)methyl]-5-(4-methoxyphenyl)-1-pentanoyl-5,8-dihydro-2H-1,4-diazocin-3-one |
| SMILES | CCCCC(=O)N1C/C=C\C(c2ccc(OC)cc2)N(Cc2ccc(F)cc2)C(=O)C1 |
| InChI | InChI=1S/C25H29FN2O3/c1-3-4-7-24(29)27-16-5-6-23(20-10-14-22(31-2)15-11-20)28(25(30)18-27)17-19-8-12-21(26)13-9-19/h5-6,8-15,23H,3-4,7,16-18H2,1-2H3/b6-5- |
| InChIKey | LXWIOYNCLXWINJ-WAYWQWQTSA-N |
| XLogP | 4.49 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|