C28H25F2NO — CID 16746288
(3R,3aS,7R,7aS)-2-benzyl-3-[2-fluoro-4-(4-fluorophenyl)phenyl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one (PubChem CID 16746288) has the molecular formula C28H25F2NO and a molecular weight of 429.51 g/mol. Its IUPAC name is (3R,3aS,7R,7aS)-2-benzyl-3-[2-fluoro-4-(4-fluorophenyl)phenyl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one.
| Compound Name | (3R,3aS,7R,7aS)-2-benzyl-3-[2-fluoro-4-(4-fluorophenyl)phenyl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one |
|---|---|
| PubChem CID | 16746288 |
| Molecular Formula | C28H25F2NO |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | (3R,3aS,7R,7aS)-2-benzyl-3-[2-fluoro-4-(4-fluorophenyl)phenyl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one |
| SMILES | C[C@@H]1CC=C[C@H]2[C@H]1C(=O)N(Cc1ccccc1)[C@H]2c1ccc(-c2ccc(F)cc2)cc1F |
| InChI | InChI=1S/C28H25F2NO/c1-18-6-5-9-24-26(18)28(32)31(17-19-7-3-2-4-8-19)27(24)23-15-12-21(16-25(23)30)20-10-13-22(29)14-11-20/h2-5,7-16,18,24,26-27H,6,17H2,1H3/t18-,24+,26+,27+/m1/s1 |
| InChIKey | HFJMJJXISOUPFA-AIRFCXSGSA-N |
| XLogP | 6.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|