C30H36FNO — CID 16746333
(3R,3aS,7R,7aS)-2-benzyl-3-[2-fluoro-4-[(E)-oct-1-enyl]phenyl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one (PubChem CID 16746333) has the molecular formula C30H36FNO and a molecular weight of 445.62 g/mol. Its IUPAC name is (3R,3aS,7R,7aS)-2-benzyl-3-[2-fluoro-4-[(E)-oct-1-enyl]phenyl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one.
| Compound Name | (3R,3aS,7R,7aS)-2-benzyl-3-[2-fluoro-4-[(E)-oct-1-enyl]phenyl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one |
|---|---|
| PubChem CID | 16746333 |
| Molecular Formula | C30H36FNO |
| Molecular Weight | 445.62 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | (3R,3aS,7R,7aS)-2-benzyl-3-[2-fluoro-4-[(E)-oct-1-enyl]phenyl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one |
| SMILES | CCCCCC/C=C/c1ccc([C@H]2[C@H]3C=CC[C@@H](C)[C@@H]3C(=O)N2Cc2ccccc2)c(F)c1 |
| InChI | InChI=1S/C30H36FNO/c1-3-4-5-6-7-9-14-23-18-19-25(27(31)20-23)29-26-17-12-13-22(2)28(26)30(33)32(29)21-24-15-10-8-11-16-24/h8-12,14-20,22,26,28-29H,3-7,13,21H2,1-2H3/b14-9+/t22-,26+,28+,29+/m1/s1 |
| InChIKey | CHNHQVSLPQQBAJ-JDTMCNAFSA-N |
| XLogP | 7.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.62 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|