C25H29FN2O5S — CID 167463399
[1-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]-4-methylpiperidin-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 167463399) has the molecular formula C25H29FN2O5S and a molecular weight of 488.58 g/mol. Its IUPAC name is [1-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]-4-methylpiperidin-4-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [1-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]-4-methylpiperidin-4-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 167463399 |
| Molecular Formula | C25H29FN2O5S |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | [1-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]-4-methylpiperidin-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2(C)CCN(c3ccc(C4CCC(=O)NC4=O)cc3F)CC2)cc1 |
| InChI | InChI=1S/C25H29FN2O5S/c1-17-3-6-19(7-4-17)34(31,32)33-16-25(2)11-13-28(14-12-25)22-9-5-18(15-21(22)26)20-8-10-23(29)27-24(20)30/h3-7,9,15,20H,8,10-14,16H2,1-2H3,(H,27,29,30) |
| InChIKey | NWXALTRMPKJUGY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|