C34H40N2O7 — CID 16746345
5,7-dimethoxy-4-methyl-8-[3-(4-phenylpiperazin-1-yl)-1-(3,4,5-trimethoxyphenyl)propyl]chromen-2-one (PubChem CID 16746345) has the molecular formula C34H40N2O7 and a molecular weight of 588.70 g/mol. Its IUPAC name is 5,7-dimethoxy-4-methyl-8-[3-(4-phenylpiperazin-1-yl)-1-(3,4,5-trimethoxyphenyl)propyl]chromen-2-one.
| Compound Name | 5,7-dimethoxy-4-methyl-8-[3-(4-phenylpiperazin-1-yl)-1-(3,4,5-trimethoxyphenyl)propyl]chromen-2-one |
|---|---|
| PubChem CID | 16746345 |
| Molecular Formula | C34H40N2O7 |
| Molecular Weight | 588.70 g/mol |
| Exact Mass | 588.28 |
| IUPAC Name | 5,7-dimethoxy-4-methyl-8-[3-(4-phenylpiperazin-1-yl)-1-(3,4,5-trimethoxyphenyl)propyl]chromen-2-one |
| SMILES | COc1cc(C(CCN2CCN(c3ccccc3)CC2)c2c(OC)cc(OC)c3c(C)cc(=O)oc23)cc(OC)c1OC |
| InChI | InChI=1S/C34H40N2O7/c1-22-18-30(37)43-34-31(22)26(38-2)21-27(39-3)32(34)25(23-19-28(40-4)33(42-6)29(20-23)41-5)12-13-35-14-16-36(17-15-35)24-10-8-7-9-11-24/h7-11,18-21,25H,12-17H2,1-6H3 |
| InChIKey | CEXHKARDBJYWJT-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 82.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.70 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|