C34H33NO3 — CID 16746370
(3R,3aS,7R,7aS)-2-benzyl-3-[1-(3,4-dimethoxyphenyl)naphthalen-2-yl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one (PubChem CID 16746370) has the molecular formula C34H33NO3 and a molecular weight of 503.64 g/mol. Its IUPAC name is (3R,3aS,7R,7aS)-2-benzyl-3-[1-(3,4-dimethoxyphenyl)naphthalen-2-yl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one.
| Compound Name | (3R,3aS,7R,7aS)-2-benzyl-3-[1-(3,4-dimethoxyphenyl)naphthalen-2-yl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one |
|---|---|
| PubChem CID | 16746370 |
| Molecular Formula | C34H33NO3 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | (3R,3aS,7R,7aS)-2-benzyl-3-[1-(3,4-dimethoxyphenyl)naphthalen-2-yl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one |
| SMILES | COc1ccc(-c2c([C@H]3[C@H]4C=CC[C@@H](C)[C@@H]4C(=O)N3Cc3ccccc3)ccc3ccccc23)cc1OC |
| InChI | InChI=1S/C34H33NO3/c1-22-10-9-15-27-31(22)34(36)35(21-23-11-5-4-6-12-23)33(27)28-18-16-24-13-7-8-14-26(24)32(28)25-17-19-29(37-2)30(20-25)38-3/h4-9,11-20,22,27,31,33H,10,21H2,1-3H3/t22-,27+,31+,33-/m1/s1 |
| InChIKey | MMDNWBOVBMBAMN-ZRAQNQHRSA-N |
| XLogP | 7.44 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|