C16H16F2N2S — CID 167463754
4-[(3,5-difluorophenyl)methyl]-2-methyl-2,3-dihydro-1,4-benzothiazin-6-amine (PubChem CID 167463754) has the molecular formula C16H16F2N2S and a molecular weight of 306.38 g/mol. Its IUPAC name is 4-[(3,5-difluorophenyl)methyl]-2-methyl-2,3-dihydro-1,4-benzothiazin-6-amine.
| Compound Name | 4-[(3,5-difluorophenyl)methyl]-2-methyl-2,3-dihydro-1,4-benzothiazin-6-amine |
|---|---|
| PubChem CID | 167463754 |
| Molecular Formula | C16H16F2N2S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-[(3,5-difluorophenyl)methyl]-2-methyl-2,3-dihydro-1,4-benzothiazin-6-amine |
| SMILES | CC1CN(Cc2cc(F)cc(F)c2)c2cc(N)ccc2S1 |
| InChI | InChI=1S/C16H16F2N2S/c1-10-8-20(9-11-4-12(17)6-13(18)5-11)15-7-14(19)2-3-16(15)21-10/h2-7,10H,8-9,19H2,1H3 |
| InChIKey | FUPMPMORIDZPNZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|