C23H24ClNO2 — CID 16746381
(3R,3aS,7R,7aS)-2-benzyl-3-(3-chloro-4-methoxyphenyl)-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one (PubChem CID 16746381) has the molecular formula C23H24ClNO2 and a molecular weight of 381.90 g/mol. Its IUPAC name is (3R,3aS,7R,7aS)-2-benzyl-3-(3-chloro-4-methoxyphenyl)-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one.
| Compound Name | (3R,3aS,7R,7aS)-2-benzyl-3-(3-chloro-4-methoxyphenyl)-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one |
|---|---|
| PubChem CID | 16746381 |
| Molecular Formula | C23H24ClNO2 |
| Molecular Weight | 381.90 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | (3R,3aS,7R,7aS)-2-benzyl-3-(3-chloro-4-methoxyphenyl)-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one |
| SMILES | COc1ccc([C@H]2[C@H]3C=CC[C@@H](C)[C@@H]3C(=O)N2Cc2ccccc2)cc1Cl |
| InChI | InChI=1S/C23H24ClNO2/c1-15-7-6-10-18-21(15)23(26)25(14-16-8-4-3-5-9-16)22(18)17-11-12-20(27-2)19(24)13-17/h3-6,8-13,15,18,21-22H,7,14H2,1-2H3/t15-,18+,21+,22+/m1/s1 |
| InChIKey | ARXXYJZQWYQNOY-VPPRVIDZSA-N |
| XLogP | 5.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.90 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|