C31H33NO3 — CID 16746407
(3R,3aS,7R,7aS)-2-benzyl-3-[2-methoxy-5-(4-methoxy-3-methylphenyl)phenyl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one (PubChem CID 16746407) has the molecular formula C31H33NO3 and a molecular weight of 467.61 g/mol. Its IUPAC name is (3R,3aS,7R,7aS)-2-benzyl-3-[2-methoxy-5-(4-methoxy-3-methylphenyl)phenyl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one.
| Compound Name | (3R,3aS,7R,7aS)-2-benzyl-3-[2-methoxy-5-(4-methoxy-3-methylphenyl)phenyl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one |
|---|---|
| PubChem CID | 16746407 |
| Molecular Formula | C31H33NO3 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | (3R,3aS,7R,7aS)-2-benzyl-3-[2-methoxy-5-(4-methoxy-3-methylphenyl)phenyl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one |
| SMILES | COc1ccc(-c2ccc(OC)c([C@H]3[C@H]4C=CC[C@@H](C)[C@@H]4C(=O)N3Cc3ccccc3)c2)cc1C |
| InChI | InChI=1S/C31H33NO3/c1-20-9-8-12-25-29(20)31(33)32(19-22-10-6-5-7-11-22)30(25)26-18-24(14-16-28(26)35-4)23-13-15-27(34-3)21(2)17-23/h5-8,10-18,20,25,29-30H,9,19H2,1-4H3/t20-,25+,29+,30-/m1/s1 |
| InChIKey | MRBLBQQLABEGTE-OFVNPCLDSA-N |
| XLogP | 6.59 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|