About 4-cyclohexyloxy-N-(3-propanoylcyclobutyl)butanamide;methanol;molecular hydrogen
4-cyclohexyloxy-N-(3-propanoylcyclobutyl)butanamide;methanol;molecular hydrogen (PubChem CID 167464080) has the molecular formula C18H35NO4
and a molecular weight of 329.48 g/mol. Its IUPAC name is 4-cyclohexyloxy-N-(3-propanoylcyclobutyl)butanamide;methanol;molecular hydrogen.
Molecular Properties
| Compound Name | 4-cyclohexyloxy-N-(3-propanoylcyclobutyl)butanamide;methanol;molecular hydrogen |
| PubChem CID | 167464080 |
| Molecular Formula | C18H35NO4 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.26 |
| IUPAC Name | 4-cyclohexyloxy-N-(3-propanoylcyclobutyl)butanamide;methanol;molecular hydrogen |
| SMILES | CCC(=O)C1CC(NC(=O)CCCOC2CCCCC2)C1.CO.[H][H] |
| InChI | InChI=1S/C17H29NO3.CH4O.H2/c1-2-16(19)13-11-14(12-13)18-17(20)9-6-10-21-15-7-4-3-5-8-15;1-2;/h13-15H,2-12H2,1H3,(H,18,20);2H,1H3;1H |
| InChIKey | XBPYFIFXSHLYEC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclohexyloxy-N-(3-propanoylcyclobutyl)butanamide;methanol;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexyloxy-N-(3-propanoylcyclobutyl)butanamide;methanol;molecular hydrogen?
The IUPAC name of 4-cyclohexyloxy-N-(3-propanoylcyclobutyl)butanamide;methanol;molecular hydrogen (CID 167464080) is 4-cyclohexyloxy-N-(3-propanoylcyclobutyl)butanamide;methanol;molecular hydrogen.
What is the SMILES notation for 4-cyclohexyloxy-N-(3-propanoylcyclobutyl)butanamide;methanol;molecular hydrogen?
The canonical SMILES for 4-cyclohexyloxy-N-(3-propanoylcyclobutyl)butanamide;methanol;molecular hydrogen is CCC(=O)C1CC(NC(=O)CCCOC2CCCCC2)C1.CO.[H][H].
What is the InChIKey of 4-cyclohexyloxy-N-(3-propanoylcyclobutyl)butanamide;methanol;molecular hydrogen?
The InChIKey is XBPYFIFXSHLYEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29NO3.CH4O.H2/c1-2-16(19)13-11-14(12-13)18-17(20)9-6-10-21-15-7-4-3-5-8-15;1-2;/h13-15H,2-12H2,1H3,(H,18,20);2H,1H3;1H.
What are the key properties of 4-cyclohexyloxy-N-(3-propanoylcyclobutyl)butanamide;methanol;molecular hydrogen?
4-cyclohexyloxy-N-(3-propanoylcyclobutyl)butanamide;methanol;molecular hydrogen has a molecular weight of 329.48 g/mol, XLogP of 2.84, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexyloxy-N-(3-propanoylcyclobutyl)butanamide;methanol;molecular hydrogen is sourced from PubChem (CID 167464080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).