C33H45NO7 — CID 16746410
5,7-dimethoxy-4-pentyl-8-[3-piperidin-1-yl-1-(3,4,5-trimethoxyphenyl)propyl]chromen-2-one (PubChem CID 16746410) has the molecular formula C33H45NO7 and a molecular weight of 567.72 g/mol. Its IUPAC name is 5,7-dimethoxy-4-pentyl-8-[3-piperidin-1-yl-1-(3,4,5-trimethoxyphenyl)propyl]chromen-2-one.
| Compound Name | 5,7-dimethoxy-4-pentyl-8-[3-piperidin-1-yl-1-(3,4,5-trimethoxyphenyl)propyl]chromen-2-one |
|---|---|
| PubChem CID | 16746410 |
| Molecular Formula | C33H45NO7 |
| Molecular Weight | 567.72 g/mol |
| Exact Mass | 567.32 |
| IUPAC Name | 5,7-dimethoxy-4-pentyl-8-[3-piperidin-1-yl-1-(3,4,5-trimethoxyphenyl)propyl]chromen-2-one |
| SMILES | CCCCCc1cc(=O)oc2c(C(CCN3CCCCC3)c3cc(OC)c(OC)c(OC)c3)c(OC)cc(OC)c12 |
| InChI | InChI=1S/C33H45NO7/c1-7-8-10-13-22-20-29(35)41-33-30(22)25(36-2)21-26(37-3)31(33)24(14-17-34-15-11-9-12-16-34)23-18-27(38-4)32(40-6)28(19-23)39-5/h18-21,24H,7-17H2,1-6H3 |
| InChIKey | KMZREGRJNGBBIZ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 79.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.72 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|